ChemNet > CAS > 3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
Nama produk |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one |
Sinonim |
1-(3,4-dimethoxyphenyl)-2-phenylethanone |
MF |
C16H16O3 |
Berat Molekul |
256.2964 |
InChI |
InChI=1/C16H16O3/c1-18-15-9-8-13(11-16(15)19-2)14(17)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
CAS NO |
3141-93-3 |
Struktur Molekul |
|
Kepadatan |
1.115g/cm3 |
Titik lebur |
87℃ |
Titik didih |
398°C at 760 mmHg |
Indeks bias |
1.558 |
Titik nyala |
186.1°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|