ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
Nama produk |
4,5-Dinitro-o-phenylenediamine |
Sinonim |
4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
MF |
C6H6N4O4 |
Berat Molekul |
198.1362 |
InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
CAS NO |
32690-28-1 |
Struktur Molekul |
|
Kepadatan |
1.683g/cm3 |
Titik lebur |
213℃ |
Titik didih |
541.1°C at 760 mmHg |
Indeks bias |
1.747 |
Titik nyala |
281°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|