ChemNet > CAS > 3815-20-1 4-Biphenylcarboxamide
3815-20-1 4-Biphenylcarboxamide
Nama produk |
4-Biphenylcarboxamide |
Sinonim |
4-Phenylbenzamide; biphenyl-4-carboxamide |
MF |
C13H11NO |
Berat Molekul |
197.2325 |
InChI |
InChI=1/C13H11NO/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H2,14,15) |
CAS NO |
3815-20-1 |
Struktur Molekul |
|
Kepadatan |
1.137g/cm3 |
Titik didih |
381.4°C at 760 mmHg |
Indeks bias |
1.605 |
Titik nyala |
184.5°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|