ChemNet > CAS > 39565-00-9 2-Acetyl-5-nitrothiophene
39565-00-9 2-Acetyl-5-nitrothiophene
Nama produk |
2-Acetyl-5-nitrothiophene |
Sinonim |
5-Nitro-2-thienyl methyl ketone; Methyl 5-nitro-2-thienyl ketone; 1-(5-nitrothiophen-2-yl)ethanone |
MF |
C6H5NO3S |
Berat Molekul |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
CAS NO |
39565-00-9 |
Struktur Molekul |
|
Kepadatan |
1.399g/cm3 |
Titik didih |
268.9°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
116.4°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|