ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
Nama produk |
2-Chloro-6-iodotoluene |
Sinonim |
1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
MF |
C7H6ClI |
Berat Molekul |
252.48 |
InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS NO |
42048-11-3 |
Struktur Molekul |
|
Kepadatan |
1.806g/cm3 |
Titik didih |
243°C at 760 mmHg |
Indeks bias |
1.616 |
Titik nyala |
100.8°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|