ChemNet > CAS > 4341-24-6 5-Methylcyclohexane-1,3-dione
4341-24-6 5-Methylcyclohexane-1,3-dione
Nama produk |
5-Methylcyclohexane-1,3-dione |
Sinonim |
(5S)-3-hydroxy-5-methylcyclohex-2-en-1-one |
MF |
C7H10O2 |
Berat Molekul |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h4-5,8H,2-3H2,1H3/t5-/m0/s1 |
CAS NO |
4341-24-6 |
Struktur Molekul |
|
Kepadatan |
1.134g/cm3 |
Titik lebur |
129-131℃ |
Titik didih |
221.6°C at 760 mmHg |
Indeks bias |
1.517 |
Titik nyala |
89.1°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|