ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
Nama produk |
4-Isopropylphenylacetonitrile |
Sinonim |
[4-(propan-2-yl)phenyl]acetonitrile |
MF |
C11H13N |
Berat Molekul |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
CAS NO |
4395-87-3 |
Struktur Molekul |
|
Kepadatan |
0.96g/cm3 |
Titik didih |
261.1°C at 760 mmHg |
Indeks bias |
1.514 |
Titik nyala |
117.5°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|