ChemNet > CAS > 4410-12-2 1-Benzylhomopiperazine
4410-12-2 1-Benzylhomopiperazine
Nama produk |
1-Benzylhomopiperazine |
Sinonim |
1-Benzylhexahydro-1,4-diazepine; N-benzylhomopiperazine; 1-benzyl-1,4-diazepane; 1-Benzyl-1,4-diazacycloheptane; 1-Benzyl-1,4-diazacycloheptanel |
MF |
C12H18N2 |
Berat Molekul |
190.2847 |
InChI |
InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
CAS NO |
4410-12-2 |
Struktur Molekul |
|
Kepadatan |
1.003g/cm3 |
Titik didih |
286.5°C at 760 mmHg |
Indeks bias |
1.536 |
Titik nyala |
116.2°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|