ChemNet > CAS > 4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
Nama produk |
1-(2-Cyanoethyl)-4-methylpiperazine |
Sinonim |
3-(4-Methylpiperazino)propionitrile; 3-(4-methylpiperazin-1-yl)propanenitrile |
MF |
C8H15N3 |
Berat Molekul |
153.2248 |
InChI |
InChI=1/C8H15N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2,4-8H2,1H3 |
CAS NO |
4491-92-3 |
Struktur Molekul |
|
Kepadatan |
0.981g/cm3 |
Titik didih |
273°C at 760 mmHg |
Indeks bias |
1.477 |
Titik nyala |
113.6°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|