ChemNet > CAS > 4731-65-1 Tris-(2-methoxyphenyl)-phosphine
4731-65-1 Tris-(2-methoxyphenyl)-phosphine
Nama produk |
Tris-(2-methoxyphenyl)-phosphine |
Sinonim |
Tris(2-methoxyphenyl)phosphine; Tri(o-anisyl)phosphine; tris(2-methoxyphenyl)phosphane; Tris(o-methoxyphenyl)phosphine |
MF |
C21H21O3P |
Berat Molekul |
352.3634 |
InChI |
InChI=1/C21H21O3P/c1-22-16-10-4-7-13-19(16)25(20-14-8-5-11-17(20)23-2)21-15-9-6-12-18(21)24-3/h4-15H,1-3H3 |
CAS NO |
4731-65-1 |
EINECS |
225-235-8 |
Struktur Molekul |
|
Titik didih |
477.3°C at 760 mmHg |
Titik nyala |
302.5°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|