ChemNet > CAS > 4771-49-7 6-Methylindole-3-caboxaldehyde
4771-49-7 6-Methylindole-3-caboxaldehyde
Nama produk |
6-Methylindole-3-caboxaldehyde |
Sinonim |
6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
MF |
C10H9NO |
Berat Molekul |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
CAS NO |
4771-49-7 |
Struktur Molekul |
|
Kepadatan |
1.226g/cm3 |
Titik didih |
339.3°C at 760 mmHg |
Indeks bias |
1.698 |
Titik nyala |
167°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|