ChemNet > CAS > 4906-24-5 3-Acetoxy-2-butanone
4906-24-5 3-Acetoxy-2-butanone
Nama produk |
3-Acetoxy-2-butanone |
Sinonim |
Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
MF |
C6H10O3 |
Berat Molekul |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
CAS NO |
4906-24-5 |
Struktur Molekul |
|
Kepadatan |
1.012g/cm3 |
Titik didih |
163.4°C at 760 mmHg |
Indeks bias |
1.406 |
Titik nyala |
56.6°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|