ChemNet > CAS > 501-24-6 3-n-Pentadecylphenol
501-24-6 3-n-Pentadecylphenol
Nama produk |
3-n-Pentadecylphenol |
Sinonim |
Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
MF |
C21H36O |
Berat Molekul |
304.5099 |
InChI |
InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
CAS NO |
501-24-6 |
EINECS |
207-921-9 |
Struktur Molekul |
|
Kepadatan |
0.908g/cm3 |
Titik lebur |
47-53℃ |
Titik didih |
402°C at 760 mmHg |
Indeks bias |
1.495 |
Titik nyala |
246.3°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|