ChemNet > CAS > 513-81-5 2,3-Dimethylbutadiene-1,3
513-81-5 2,3-Dimethylbutadiene-1,3
| Nama produk |
2,3-Dimethylbutadiene-1,3 |
| Sinonim |
2,3-Dimethyl-1,3-butadiene; 2,3-dimethylbuta-1,3-diene |
| MF |
C6H10 |
| Berat Molekul |
82.1436 |
| InChI |
InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| CAS NO |
513-81-5 |
| EINECS |
208-172-0 |
| Struktur Molekul |
|
| Kepadatan |
0.699g/cm3 |
| Titik didih |
68.8°C at 760 mmHg |
| Indeks bias |
1.408 |
| Simbol bahaya |
|
| Kode Risiko |
R11:Highly flammable.;
R65:Harmful: may cause lung damage if swallowed.;
|
| Keselamatan Deskripsi |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S33:Take precautionary measures against static discharges.;
S62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.;
|
|
