ChemNet > CAS > 51632-28-1 4-Ethylphenylacetonitrile
51632-28-1 4-Ethylphenylacetonitrile
Nama produk |
4-Ethylphenylacetonitrile |
Sinonim |
4-Ethylbenzyl cyanide |
MF |
C10H11N |
Berat Molekul |
145.201 |
InChI |
InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
CAS NO |
51632-28-1 |
Struktur Molekul |
|
Kepadatan |
0.978g/cm3 |
Titik didih |
252.8°C at 760 mmHg |
Indeks bias |
1.521 |
Titik nyala |
116.1°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|