ChemNet > CAS > 524-42-5 1,2-Naphthoquinone
524-42-5 1,2-Naphthoquinone
Nama produk |
1,2-Naphthoquinone |
Sinonim |
1,2-Naphthalenedione; 1,2-naphthoquinone (beta); naphthalene-1,2-dione |
MF |
C10H6O2 |
Berat Molekul |
158.1534 |
InChI |
InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
CAS NO |
524-42-5 |
EINECS |
208-360-2 |
Struktur Molekul |
|
Kepadatan |
1.29g/cm3 |
Titik lebur |
136-141℃ |
Titik didih |
296.1°C at 760 mmHg |
Indeks bias |
1.617 |
Titik nyala |
117.4°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|