CAS No: 52663-68-0, Chemical Name: 2,2',3,4',5,5',6-heptachlorobiphenyl
the physical and chemical property of 52663-68-0, 2,2',3,4',5,5',6-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 52663-68-0 2,2',3,4',5,5',6-heptachlorobiphenyl
52663-68-0 2,2',3,4',5,5',6-heptachlorobiphenyl
Nama produk |
2,2',3,4',5,5',6-heptachlorobiphenyl |
Sinonim |
1,1'-biphenyl, 2,2',3,4',5,5',6-heptachloro-; 2,2',3,4',5,5',6-Heptachlorobiphenyl; 2,2',3,4',5,5',6-PCB; 52663-68-0 |
MF |
C12H3Cl7 |
Berat Molekul |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-5-2-7(15)6(14)1-4(5)10-11(18)8(16)3-9(17)12(10)19/h1-3H |
CAS NO |
52663-68-0 |
Struktur Molekul |
|
Kepadatan |
1.658g/cm3 |
Titik didih |
408.2°C at 760 mmHg |
Indeks bias |
1.632 |
Titik nyala |
198.9°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|