ChemNet > CAS > 5306-96-7 2,3-Dimethyl-p-phenylenediamine
5306-96-7 2,3-Dimethyl-p-phenylenediamine
Nama produk |
2,3-Dimethyl-p-phenylenediamine |
Sinonim |
p-Phenylenediamine, 2,3-dimethyl-; 4-Amino-5,6-dimethylaniline; CCRIS 8132; 2,3-dimethylbenzene-1,4-diamine; 1,4-Diamino-2,3-dimethylbenzene |
MF |
C8H12N2 |
Berat Molekul |
136.1943 |
InChI |
InChI=1/C8H12N2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,9-10H2,1-2H3 |
CAS NO |
5306-96-7 |
Struktur Molekul |
|
Kepadatan |
1.076g/cm3 |
Titik didih |
288.5°C at 760 mmHg |
Indeks bias |
1.618 |
Titik nyala |
151.5°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|