ChemNet > CAS > 5332-96-7 4-Nitrophenylacetone
5332-96-7 4-Nitrophenylacetone
Nama produk |
4-Nitrophenylacetone |
Sinonim |
1-(4-Nitrophenyl)-2-propanone; 1-(4-nitrophenyl)propan-2-one |
MF |
C9H9NO3 |
Berat Molekul |
179.1727 |
InChI |
InChI=1/C9H9NO3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3 |
CAS NO |
5332-96-7 |
Struktur Molekul |
|
Kepadatan |
1.212g/cm3 |
Titik lebur |
63-64℃ |
Titik didih |
307.5°C at 760 mmHg |
Indeks bias |
1.549 |
Titik nyala |
146.4°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|