ChemNet > CAS > 5372-23-6 4-Cyano-5-imidazolecarboxamide
5372-23-6 4-Cyano-5-imidazolecarboxamide
Nama produk |
4-Cyano-5-imidazolecarboxamide |
Sinonim |
4-Cyano-1H-imidazole-5-carboxamide |
MF |
C5H4N4O |
Berat Molekul |
136.1115 |
InChI |
InChI=1/C5H4N4O/c6-1-3-4(5(7)10)9-2-8-3/h2H,(H2,7,10)(H,8,9) |
CAS NO |
5372-23-6 |
Struktur Molekul |
|
Kepadatan |
1.51g/cm3 |
Titik lebur |
276℃ |
Titik didih |
572.8°C at 760 mmHg |
Indeks bias |
1.617 |
Titik nyala |
300.2°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|