ChemNet > CAS > 53744-28-8 3,4-Dimethoxychalcone
53744-28-8 3,4-Dimethoxychalcone
Nama produk |
3,4-Dimethoxychalcone |
Sinonim |
3,4-Dimethoxybenzylideneacetophenone; (2E)-3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one |
MF |
C17H16O3 |
Berat Molekul |
268.3071 |
InChI |
InChI=1/C17H16O3/c1-19-16-11-9-13(12-17(16)20-2)8-10-15(18)14-6-4-3-5-7-14/h3-12H,1-2H3/b10-8+ |
CAS NO |
53744-28-8 |
Struktur Molekul |
|
Kepadatan |
1.128g/cm3 |
Titik didih |
421.8°C at 760 mmHg |
Indeks bias |
1.591 |
Titik nyala |
200.7°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|