ChemNet > CAS > 5585-33-1 2-(4-Morpholino)aniline
5585-33-1 2-(4-Morpholino)aniline
Nama produk |
2-(4-Morpholino)aniline |
Sinonim |
4-(2-Aminophenyl)morpholine; 2-(morpholin-4-yl)aniline; 2-morpholinoaniline |
MF |
C10H14N2O |
Berat Molekul |
178.231 |
InChI |
InChI=1/C10H14N2O/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
CAS NO |
5585-33-1 |
Struktur Molekul |
|
Kepadatan |
1.149g/cm3 |
Titik lebur |
93℃ |
Titik didih |
332.5°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
154.9°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|