ChemNet > CAS > 58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
Nama produk |
1-(5-nitro-3-thienyl)ethan-1-one |
Sinonim |
4-Acetyl-2-nitrothiophene; 1-(5-nitrothiophen-3-yl)ethanone |
MF |
C6H5NO3S |
Berat Molekul |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-6(7(9)10)11-3-5/h2-3H,1H3 |
CAS NO |
58157-89-4 |
Struktur Molekul |
|
Kepadatan |
1.399g/cm3 |
Titik lebur |
59℃ |
Titik didih |
247.9°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
103.7°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|