ChemNet > CAS > 58586-81-5 4-Ethoxybenzhydrazide
58586-81-5 4-Ethoxybenzhydrazide
Nama produk |
4-Ethoxybenzhydrazide |
Sinonim |
4-ethoxybenzohydrazide |
MF |
C9H12N2O2 |
Berat Molekul |
180.2038 |
InChI |
InChI=1/C9H12N2O2/c1-2-13-8-5-3-7(4-6-8)9(12)11-10/h3-6H,2,10H2,1H3,(H,11,12) |
CAS NO |
58586-81-5 |
Struktur Molekul |
|
Kepadatan |
1.144g/cm3 |
Indeks bias |
1.549 |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|