ChemNet > CAS > 66298-09-7 2,4-Dimethylphenylthiosemicarbazide
66298-09-7 2,4-Dimethylphenylthiosemicarbazide
Nama produk |
2,4-Dimethylphenylthiosemicarbazide |
Sinonim |
4-(2,4-Dimethylphenyl)-3-thiosemicarbazide; N-(2,4-dimethylphenyl)hydrazinecarbothioamide |
MF |
C9H13N3S |
Berat Molekul |
195.2846 |
InChI |
InChI=1/C9H13N3S/c1-6-3-4-8(7(2)5-6)11-9(13)12-10/h3-5H,10H2,1-2H3,(H2,11,12,13) |
CAS NO |
66298-09-7 |
Struktur Molekul |
|
Kepadatan |
1.228g/cm3 |
Titik didih |
310.5°C at 760 mmHg |
Indeks bias |
1.678 |
Titik nyala |
141.6°C |
Simbol bahaya |
|
Kode Risiko |
R25:Toxic if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|