ChemNet > CAS > 67073-39-6 4-Chloro-5-nitro-o-phenylenediamine
67073-39-6 4-Chloro-5-nitro-o-phenylenediamine
Nama produk |
4-Chloro-5-nitro-o-phenylenediamine |
Sinonim |
4-chloro-5-nitrobenzene-1,2-diamine |
MF |
C6H6ClN3O2 |
Berat Molekul |
187.5837 |
InChI |
InChI=1/C6H6ClN3O2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H,8-9H2 |
CAS NO |
67073-39-6 |
Struktur Molekul |
|
Kepadatan |
1.592g/cm3 |
Titik lebur |
189℃ |
Titik didih |
458.9°C at 760 mmHg |
Indeks bias |
1.712 |
Titik nyala |
231.3°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|