ChemNet > CAS > 68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
Nama produk |
4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine |
Sinonim |
6-(methoxymethyl)-2-(methylsulfanyl)pyrimidin-4(1H)-one |
MF |
C7H10N2O2S |
Berat Molekul |
186.2315 |
InChI |
InChI=1/C7H10N2O2S/c1-11-4-5-3-6(10)9-7(8-5)12-2/h3H,4H2,1-2H3,(H,8,9,10) |
CAS NO |
68087-13-8 |
Struktur Molekul |
|
Kepadatan |
1.3g/cm3 |
Titik didih |
286.6°C at 760 mmHg |
Indeks bias |
1.588 |
Titik nyala |
127.2°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|