ChemNet > CAS > 6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
Nama produk |
2-Chloro-N-(2,6-diethylphenyl)-acetamide |
Sinonim |
N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
MF |
C12H16ClNO |
Berat Molekul |
225.7145 |
InChI |
InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
CAS NO |
6967-29-9 |
Struktur Molekul |
|
Kepadatan |
1.131g/cm3 |
Titik didih |
369.2°C at 760 mmHg |
Indeks bias |
1.559 |
Titik nyala |
177.1°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|