ChemNet > CAS > 7391-28-8 4-Methylbenzoylacetonitrile
7391-28-8 4-Methylbenzoylacetonitrile
Nama produk |
4-Methylbenzoylacetonitrile |
Sinonim |
p-Toluoylacetonitrile; 3-oxo-3-p-tolylpropanenitrile; 3-(4-methylphenyl)-3-oxopropanenitrile |
MF |
C10H9NO |
Berat Molekul |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-8-2-4-9(5-3-8)10(12)6-7-11/h2-5H,6H2,1H3 |
CAS NO |
7391-28-8 |
Struktur Molekul |
|
Kepadatan |
1.081g/cm3 |
Titik lebur |
100-102℃ |
Titik didih |
318.2°C at 760 mmHg |
Indeks bias |
1.532 |
Titik nyala |
146.2°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|