ChemNet > CAS > 83935-45-9 1-(4-Acetylphenyl)-2,5-dimethylpyrrole
83935-45-9 1-(4-Acetylphenyl)-2,5-dimethylpyrrole
Nama produk |
1-(4-Acetylphenyl)-2,5-dimethylpyrrole |
Sinonim |
1-[4-(2,5-dimethyl-1H-pyrrol-1-yl)phenyl]ethanone |
MF |
C14H15NO |
Berat Molekul |
213.275 |
InChI |
InChI=1/C14H15NO/c1-10-4-5-11(2)15(10)14-8-6-13(7-9-14)12(3)16/h4-9H,1-3H3 |
CAS NO |
83935-45-9 |
Struktur Molekul |
|
Kepadatan |
1.03g/cm3 |
Titik didih |
354.8°C at 760 mmHg |
Indeks bias |
1.554 |
Titik nyala |
168.4°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|