ChemNet > CAS > 85507-79-5 diundecyl phthalate, branched and linear
85507-79-5 diundecyl phthalate, branched and linear
Nama produk |
diundecyl phthalate, branched and linear |
Sinonim |
1,2-Benzenedicarboxylic acid, 1,2-diundecyl ester, branched and linear; 1,2-Benzenedicarboxylic acid, diundecyl ester, branched and linear; Diundecyl phthalate, branched and linear; dodecyl (2R,3S)-3-ethyl-2-propylhexyl benzene-1,2-dicarboxylate; DUP |
MF |
C31H52O4 |
Berat Molekul |
488.7422 |
InChI |
InChI=1/C31H52O4/c1-5-9-10-11-12-13-14-15-16-19-24-34-30(32)28-22-17-18-23-29(28)31(33)35-25-27(21-7-3)26(8-4)20-6-2/h17-18,22-23,26-27H,5-16,19-21,24-25H2,1-4H3/t26-,27-/m0/s1 |
CAS NO |
85507-79-5 |
EINECS |
287-401-6 |
Struktur Molekul |
|
Kepadatan |
0.953g/cm3 |
Titik didih |
455°C at 760 mmHg |
Indeks bias |
1.485 |
Titik nyala |
244.1°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|