ChemNet > CAS > 90064-46-3 1-Chloro-4-iodo-2,5-dimethoxy-benzene
90064-46-3 1-Chloro-4-iodo-2,5-dimethoxy-benzene
Nama produk |
1-Chloro-4-iodo-2,5-dimethoxy-benzene |
Sinonim |
1-Chloro-4-iodo-2,5-dimethoxybenzene |
MF |
C8H8ClIO2 |
Berat Molekul |
298.5054 |
InChI |
InChI=1/C8H8ClIO2/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4H,1-2H3 |
CAS NO |
90064-46-3 |
Struktur Molekul |
|
Kepadatan |
1.74g/cm3 |
Titik lebur |
115℃ |
Titik didih |
324.8°C at 760 mmHg |
Indeks bias |
1.584 |
Titik nyala |
150.2°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|