ChemNet > CAS > 91182-77-3 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride
91182-77-3 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride
Nama produk |
3-methyl-5-phenyl-4-isoxazolecarbonyl chloride |
Sinonim |
3-methyl-5-phenylisoxazole-4-carbonyl chloride |
MF |
C11H8ClNO2 |
Berat Molekul |
221.6397 |
InChI |
InChI=1/C11H8ClNO2/c1-7-9(11(12)14)10(15-13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
CAS NO |
91182-77-3 |
Struktur Molekul |
|
Kepadatan |
1.278g/cm3 |
Titik didih |
369.1°C at 760 mmHg |
Indeks bias |
1.562 |
Titik nyala |
177°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|