ChemNet > CAS > 944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
944-43-4 4-amino-2,3,5,6-tetrafluorobenzoic acid
Nama produk |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
MF |
C7H3F4NO2 |
Berat Molekul |
209.0978 |
InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
CAS NO |
944-43-4 |
EINECS |
213-409-6 |
Struktur Molekul |
|
Kepadatan |
1.726g/cm3 |
Titik lebur |
185-187℃ |
Titik didih |
283.6°C at 760 mmHg |
Indeks bias |
1.529 |
Titik nyala |
125.3°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|