ChemNet > CAS > 954-81-4 N-(5-Bromopentyl)phthalimide
954-81-4 N-(5-Bromopentyl)phthalimide
Nama produk |
N-(5-Bromopentyl)phthalimide |
Sinonim |
2-(5-bromopentyl)-1H-isoindole-1,3(2H)-dione |
MF |
C13H14BrNO2 |
Berat Molekul |
296.1598 |
InChI |
InChI=1/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
CAS NO |
954-81-4 |
Struktur Molekul |
|
Kepadatan |
1.459g/cm3 |
Titik didih |
393.1°C at 760 mmHg |
Indeks bias |
1.591 |
Titik nyala |
191.5°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|