ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
שם המוצר |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
מולקולרית פורמולה |
C7H11FO2 |
משקל מולקולרי |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
מספר CAS |
1171-47-7 |
מבנה מולקולרי |
|
צפיפות |
1.159g/cm3 |
נקודת רתיחה |
227.566°C at 760 mmHg |
משקל סגולי |
1.454 |
נקודת הבזק |
91.429°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|