ChemNet > CAS > 1190-92-7 1-Dimethylamino-2-nitroethylene
1190-92-7 1-Dimethylamino-2-nitroethylene
שם המוצר |
1-Dimethylamino-2-nitroethylene |
נרדפות |
1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
מולקולרית פורמולה |
C4H8N2O2 |
משקל מולקולרי |
116.1185 |
InChI |
InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
מספר CAS |
1190-92-7 |
מבנה מולקולרי |
|
צפיפות |
1.073g/cm3 |
נקודת רתיחה |
161.1°C at 760 mmHg |
משקל סגולי |
1.473 |
נקודת הבזק |
51.2°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|