ChemNet > CAS > 130560-97-3 3-chloro-4-fluorothiobenzamide
130560-97-3 3-chloro-4-fluorothiobenzamide
שם המוצר |
3-chloro-4-fluorothiobenzamide |
נרדפות |
3-Chloro-4-fluorobenzene-1-carbothioamide; 3-chloro-4-fluorobenzenecarbothioamide |
מולקולרית פורמולה |
C7H5ClFNS |
משקל מולקולרי |
189.6377 |
InChI |
InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11) |
מספר CAS |
130560-97-3 |
מבנה מולקולרי |
|
צפיפות |
1.434g/cm3 |
נקודת ההתוך |
129-130℃ |
נקודת רתיחה |
285.5°C at 760 mmHg |
משקל סגולי |
1.635 |
נקודת הבזק |
126.5°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|