ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
| שם המוצר |
3-Iodophenylacetonitrile |
| נרדפות |
3-Iodobenzyl cyanide |
| מולקולרית פורמולה |
C8H6IN |
| משקל מולקולרי |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| מספר CAS |
130723-54-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.764g/cm3 |
| נקודת רתיחה |
308.6°C at 760 mmHg |
| משקל סגולי |
1.624 |
| נקודת הבזק |
140.4°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
