ChemNet > CAS > 13195-79-4 alpha,alpha,4-Tribromoacetophenone
13195-79-4 alpha,alpha,4-Tribromoacetophenone
שם המוצר |
alpha,alpha,4-Tribromoacetophenone |
נרדפות |
Acetophenone, 2,2,4'-tribromo-; 2,2,4'-Tribromoacetophenone; 2,2-Dibromo-1-(4-bromophenyl)ethanone; 3-07-00-00987 (Beilstein Handbook Reference); 4,alpha,alpha-Tribromoacetophenone; 4alpha,alpha-Tribromoacetophenone; BRN 1949157; NSC 78440; 2,2-Dibromo-1-(4-bromophenyl)ethan-1-one; Ethanone, 2,2-dibromo-1-(4-bromophenyl)- (9CI); 3-amino-2-methylquinazolin-4(3H)-one |
מולקולרית פורמולה |
C9H9N3O |
משקל מולקולרי |
175.1873 |
InChI |
InChI=1/C9H9N3O/c1-6-11-8-5-3-2-4-7(8)9(13)12(6)10/h2-5H,10H2,1H3 |
מספר CAS |
13195-79-4 |
EINECS |
236-161-0 |
מבנה מולקולרי |
|
צפיפות |
1.35g/cm3 |
נקודת רתיחה |
348.1°C at 760 mmHg |
משקל סגולי |
1.675 |
נקודת הבזק |
164.4°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
R36:Irritating to eyes.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|