ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| שם המוצר |
2-acetyl-3-methylthiophene |
| נרדפות |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| מולקולרית פורמולה |
C7H8OS |
| משקל מולקולרי |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| מספר CAS |
13679-72-6 |
| EINECS |
237-179-1 |
| מבנה מולקולרי |
|
| צפיפות |
1.106g/cm3 |
| נקודת רתיחה |
214.9°C at 760 mmHg |
| משקל סגולי |
1.535 |
| נקודת הבזק |
92.3°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
