ChemNet > CAS > 144284-24-2 2,3,4-trifluorobenzyl alcohol
144284-24-2 2,3,4-trifluorobenzyl alcohol
שם המוצר |
2,3,4-trifluorobenzyl alcohol |
נרדפות |
1,2,3-trifluoro-4-methoxybenzene; (2,3,4-trifluorophenyl)methanol |
מולקולרית פורמולה |
C7H5F3O |
משקל מולקולרי |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
מספר CAS |
144284-24-2 |
מבנה מולקולרי |
|
צפיפות |
1.398g/cm3 |
נקודת רתיחה |
195.5°C at 760 mmHg |
משקל סגולי |
1.476 |
נקודת הבזק |
84.5°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|