ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
שם המוצר |
4,4'-Biphenyldicarbonitrile |
נרדפות |
4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
מולקולרית פורמולה |
C14H8N2 |
משקל מולקולרי |
204.2267 |
InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
מספר CAS |
1591-30-6 |
EINECS |
216-468-6 |
מבנה מולקולרי |
|
צפיפות |
1.2g/cm3 |
נקודת ההתוך |
236-236℃ |
נקודת רתיחה |
403.5°C at 760 mmHg |
משקל סגולי |
1.631 |
נקודת הבזק |
199.2°C |
Hazard סימנים |
|
סיכונים קודי |
R20/22:Harmful by inhalation and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|