ChemNet > CAS > 1664-54-6 3-Aminophenylpropanoic Acid
1664-54-6 3-Aminophenylpropanoic Acid
| שם המוצר |
3-Aminophenylpropanoic Acid |
| נרדפות |
3-(3-Aminophenyl)propionic acid; 3-amino-3-phenylpropanoic acid; 3-(3-aminophenyl)propanoic acid |
| מולקולרית פורמולה |
C9H11NO2 |
| משקל מולקולרי |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5,10H2,(H,11,12) |
| מספר CAS |
1664-54-6 |
| EINECS |
210-371-2 |
| מבנה מולקולרי |
|
| צפיפות |
1.217g/cm3 |
| נקודת רתיחה |
356.2°C at 760 mmHg |
| משקל סגולי |
1.597 |
| נקודת הבזק |
169.2°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
