ChemNet > CAS > 170924-52-4 2-chloro-6-fluorobenzylmercaptan
170924-52-4 2-chloro-6-fluorobenzylmercaptan
| שם המוצר |
2-chloro-6-fluorobenzylmercaptan |
| נרדפות |
2-Chloro-6-fluorobenzylthiol; (2-Chloro-6-fluorophenyl)methanethiol |
| מולקולרית פורמולה |
C7H6ClFS |
| משקל מולקולרי |
176.6389 |
| InChI |
InChI=1/C7H6ClFS/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 |
| מספר CAS |
170924-52-4 |
| מבנה מולקולרי |
|
| צפיפות |
1.299g/cm3 |
| נקודת רתיחה |
227.8°C at 760 mmHg |
| משקל סגולי |
1.559 |
| נקודת הבזק |
91.6°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
