ChemNet > CAS > 17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
שם המוצר |
4,4'-Dimethoxy-2,2'-bipyridine |
נרדפות |
4,4'-Dimethoxy-[2,2']bipyridinyl |
מולקולרית פורמולה |
C12H12N2O2 |
משקל מולקולרי |
216.2359 |
InChI |
InChI=1/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
מספר CAS |
17217-57-1 |
מבנה מולקולרי |
|
צפיפות |
1.143g/cm3 |
נקודת ההתוך |
170-171℃ |
נקודת רתיחה |
347.6°C at 760 mmHg |
משקל סגולי |
1.551 |
נקודת הבזק |
127°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|