ChemNet > CAS > 187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
שם המוצר |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
נרדפות |
[2,4-bis(methylsulfonyl)phenyl]hydrazine; 1-(1-benzofuran-3-yl)-2-bromoethanone |
מולקולרית פורמולה |
C10H7BrO2 |
משקל מולקולרי |
239.0654 |
InChI |
InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
מספר CAS |
187657-92-7 |
EINECS |
260-718-7 |
מבנה מולקולרי |
|
צפיפות |
1.582g/cm3 |
נקודת ההתוך |
136℃ |
נקודת רתיחה |
306.8°C at 760 mmHg |
משקל סגולי |
1.636 |
נקודת הבזק |
139.3°C |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|