ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| שם המוצר |
2-(difluoromethoxy)aniline |
| נרדפות |
2-Difluoromethoxyaniline |
| מולקולרית פורמולה |
C7H7F2NO |
| משקל מולקולרי |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| מספר CAS |
22236-04-0 |
| מבנה מולקולרי |
|
| צפיפות |
1.253g/cm3 |
| נקודת רתיחה |
209.8°C at 760 mmHg |
| משקל סגולי |
1.501 |
| נקודת הבזק |
80.7°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
