ChemNet > CAS > 22814-92-2 4-(4-Chlorophenyl)-thiosemicarbazide
22814-92-2 4-(4-Chlorophenyl)-thiosemicarbazide
| שם המוצר |
4-(4-Chlorophenyl)-thiosemicarbazide |
| נרדפות |
4-(4-Chlorophenyl)-3-thiosemicarbazide; N-(4-chlorophenyl)hydrazinecarbothioamide |
| מולקולרית פורמולה |
C7H8ClN3S |
| משקל מולקולרי |
201.6765 |
| InChI |
InChI=1/C7H8ClN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
| מספר CAS |
22814-92-2 |
| מבנה מולקולרי |
|
| צפיפות |
1.458g/cm3 |
| נקודת רתיחה |
318.3°C at 760 mmHg |
| משקל סגולי |
1.729 |
| נקודת הבזק |
146.3°C |
| Hazard סימנים |
|
| סיכונים קודי |
R25:Toxic if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
