ChemNet > CAS > 23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
שם המוצר |
diethylenetriamine-pentaacetic acid dianhydride |
נרדפות |
Diethylenetriaminepentaacetic acid dianhydride; DTPA Dianhydride; N,N-bis[2-(2,6-dioxomorpholin-4-yl)ethyl]glycine |
מולקולרית פורמולה |
C14H19N3O8 |
משקל מולקולרי |
357.316 |
InChI |
InChI=1/C14H19N3O8/c18-10(19)5-15(1-3-16-6-11(20)24-12(21)7-16)2-4-17-8-13(22)25-14(23)9-17/h1-9H2,(H,18,19) |
מספר CAS |
23911-26-4 |
מבנה מולקולרי |
|
צפיפות |
1.46g/cm3 |
נקודת ההתוך |
190-184℃ |
נקודת רתיחה |
656.2°C at 760 mmHg |
משקל סגולי |
1.558 |
נקודת הבזק |
350.6°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|